C15H25N3O3 — CID 155876819
1-[(3aR,5R,7aR)-5-(4-methylpiperazine-1-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone (PubChem CID 155876819) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[(3aR,5R,7aR)-5-(4-methylpiperazine-1-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone.
| Compound Name | 1-[(3aR,5R,7aR)-5-(4-methylpiperazine-1-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone |
|---|---|
| PubChem CID | 155876819 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[(3aR,5R,7aR)-5-(4-methylpiperazine-1-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2O[C@@H](C(=O)N3CCN(C)CC3)CC[C@H]21 |
| InChI | InChI=1S/C15H25N3O3/c1-11(19)18-6-5-13-12(18)3-4-14(21-13)15(20)17-9-7-16(2)8-10-17/h12-14H,3-10H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | YVUONAMOHCJZSI-MGPQQGTHSA-N |
| XLogP | -0.07 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |