C14H31NO — CID 140740968
3,3,7,7-tetramethyl-6-(methylamino)nonan-4-ol (PubChem CID 140740968) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is 3,3,7,7-tetramethyl-6-(methylamino)nonan-4-ol.
| Compound Name | 3,3,7,7-tetramethyl-6-(methylamino)nonan-4-ol |
|---|---|
| PubChem CID | 140740968 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 3,3,7,7-tetramethyl-6-(methylamino)nonan-4-ol |
| SMILES | CCC(C)(C)C(O)CC(NC)C(C)(C)CC |
| InChI | InChI=1S/C14H31NO/c1-8-13(3,4)11(15-7)10-12(16)14(5,6)9-2/h11-12,15-16H,8-10H2,1-7H3 |
| InChIKey | SPUGROCZDRPALO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |