C22H28NO3S2+ — CID 140741716
2-[4-(benzenesulfonyl)thiomorpholin-1-ium-1-yl]-1-(4-propan-2-ylphenyl)propan-1-one (PubChem CID 140741716) has the molecular formula C22H28NO3S2+ and a molecular weight of 418.60 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)thiomorpholin-1-ium-1-yl]-1-(4-propan-2-ylphenyl)propan-1-one.
| Compound Name | 2-[4-(benzenesulfonyl)thiomorpholin-1-ium-1-yl]-1-(4-propan-2-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 140741716 |
| Molecular Formula | C22H28NO3S2+ |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[4-(benzenesulfonyl)thiomorpholin-1-ium-1-yl]-1-(4-propan-2-ylphenyl)propan-1-one |
| SMILES | CC(C)c1ccc(C(=O)C(C)[S+]2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28NO3S2/c1-17(2)19-9-11-20(12-10-19)22(24)18(3)27-15-13-23(14-16-27)28(25,26)21-7-5-4-6-8-21/h4-12,17-18H,13-16H2,1-3H3/q+1 |
| InChIKey | ZXEZNVBTRKUZGR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|