C31H47NO4Si — CID 140741832
tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pentoxypyrrolidine-1-carboxylate (PubChem CID 140741832) has the molecular formula C31H47NO4Si and a molecular weight of 525.81 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pentoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pentoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140741832 |
| Molecular Formula | C31H47NO4Si |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 525.33 |
| IUPAC Name | tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-pentoxypyrrolidine-1-carboxylate |
| SMILES | CCCCCO[C@@H]1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C31H47NO4Si/c1-8-9-16-21-34-26-22-25(32(23-26)29(33)36-30(2,3)4)24-35-37(31(5,6)7,27-17-12-10-13-18-27)28-19-14-11-15-20-28/h10-15,17-20,25-26H,8-9,16,21-24H2,1-7H3/t25-,26-/m1/s1 |
| InChIKey | FTJBJROFOYXZMO-CLJLJLNGSA-N |
| XLogP | 6.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|