C28H23N3O3 — CID 140745450
phenyl N-[1-[(4-methoxyphenyl)methyl]-3-phenylindazol-7-yl]carbamate (PubChem CID 140745450) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is phenyl N-[1-[(4-methoxyphenyl)methyl]-3-phenylindazol-7-yl]carbamate.
| Compound Name | phenyl N-[1-[(4-methoxyphenyl)methyl]-3-phenylindazol-7-yl]carbamate |
|---|---|
| PubChem CID | 140745450 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | phenyl N-[1-[(4-methoxyphenyl)methyl]-3-phenylindazol-7-yl]carbamate |
| SMILES | COc1ccc(Cn2nc(-c3ccccc3)c3cccc(NC(=O)Oc4ccccc4)c32)cc1 |
| InChI | InChI=1S/C28H23N3O3/c1-33-22-17-15-20(16-18-22)19-31-27-24(26(30-31)21-9-4-2-5-10-21)13-8-14-25(27)29-28(32)34-23-11-6-3-7-12-23/h2-18H,19H2,1H3,(H,29,32) |
| InChIKey | RGGGIMNYRPGWCN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |