C31H36N2O3Si — CID 54383318
1-[5-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-[(4-methoxyphenyl)methyl]-3-phenylpyrazol-4-yl]ethanone (PubChem CID 54383318) has the molecular formula C31H36N2O3Si and a molecular weight of 512.73 g/mol. Its IUPAC name is 1-[5-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-[(4-methoxyphenyl)methyl]-3-phenylpyrazol-4-yl]ethanone.
| Compound Name | 1-[5-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-[(4-methoxyphenyl)methyl]-3-phenylpyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 54383318 |
| Molecular Formula | C31H36N2O3Si |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 1-[5-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-[(4-methoxyphenyl)methyl]-3-phenylpyrazol-4-yl]ethanone |
| SMILES | COc1ccc(Cn2nc(-c3ccccc3)c(C(C)=O)c2-c2cccc(O[Si](C)(C)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C31H36N2O3Si/c1-22(34)28-29(24-12-9-8-10-13-24)32-33(21-23-16-18-26(35-5)19-17-23)30(28)25-14-11-15-27(20-25)36-37(6,7)31(2,3)4/h8-20H,21H2,1-7H3 |
| InChIKey | VBMHWSZEDCITND-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|