C17H17BrN2O5 — CID 140745533
ethyl 3-bromo-5-isocyano-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate (PubChem CID 140745533) has the molecular formula C17H17BrN2O5 and a molecular weight of 409.24 g/mol. Its IUPAC name is ethyl 3-bromo-5-isocyano-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-bromo-5-isocyano-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 140745533 |
| Molecular Formula | C17H17BrN2O5 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | ethyl 3-bromo-5-isocyano-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate |
| SMILES | [C-]#[N+]c1[nH]c(C(=O)OCC)c(Br)c1-c1ccc(CO)c(CO)c1CO |
| InChI | InChI=1S/C17H17BrN2O5/c1-3-25-17(24)15-14(18)13(16(19-2)20-15)10-5-4-9(6-21)11(7-22)12(10)8-23/h4-5,20-23H,3,6-8H2,1H3 |
| InChIKey | MDTLSBCXPKDQHK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 107.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|