C51H32F2N4O2 — CID 140745726
4,7-bis([1]benzofuro[2,3-b]carbazol-7-yl)-2,2-difluoro-6-isocyano-1,1,3,3-tetramethylindene-5-carbonitrile (PubChem CID 140745726) has the molecular formula C51H32F2N4O2 and a molecular weight of 770.84 g/mol. Its IUPAC name is 4,7-bis([1]benzofuro[2,3-b]carbazol-7-yl)-2,2-difluoro-6-isocyano-1,1,3,3-tetramethylindene-5-carbonitrile.
| Compound Name | 4,7-bis([1]benzofuro[2,3-b]carbazol-7-yl)-2,2-difluoro-6-isocyano-1,1,3,3-tetramethylindene-5-carbonitrile |
|---|---|
| PubChem CID | 140745726 |
| Molecular Formula | C51H32F2N4O2 |
| Molecular Weight | 770.84 g/mol |
| Exact Mass | 770.25 |
| IUPAC Name | 4,7-bis([1]benzofuro[2,3-b]carbazol-7-yl)-2,2-difluoro-6-isocyano-1,1,3,3-tetramethylindene-5-carbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(-n2c3ccccc3c3cc4c(cc32)oc2ccccc24)c2c(c1-n1c3ccccc3c3cc4c(cc31)oc1ccccc14)C(C)(C)C(F)(F)C2(C)C |
| InChI | InChI=1S/C51H32F2N4O2/c1-49(2)44-45(50(3,4)51(49,52)53)48(57-37-19-11-7-15-28(37)32-23-34-30-17-9-13-21-41(30)59-43(34)25-39(32)57)46(55-5)35(26-54)47(44)56-36-18-10-6-14-27(36)31-22-33-29-16-8-12-20-40(29)58-42(33)24-38(31)56/h6-25H,1-4H3 |
| InChIKey | DZJPLBQOMAPBOH-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 64.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.84 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|