C34H31NO3 — CID 140746561
(3R,4R)-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one (PubChem CID 140746561) has the molecular formula C34H31NO3 and a molecular weight of 501.63 g/mol. Its IUPAC name is (3R,4R)-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one.
| Compound Name | (3R,4R)-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
|---|---|
| PubChem CID | 140746561 |
| Molecular Formula | C34H31NO3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (3R,4R)-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
| SMILES | C=C(C)C(=O)[C@@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C34H31NO3/c1-25(2)32(36)31-30(24-38-23-26-15-7-3-8-16-26)35(33(31)37)34(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,30-31H,1,23-24H2,2H3/t30-,31+/m0/s1 |
| InChIKey | RTVJLUBCQWVHQY-IOWSJCHKSA-N |
| XLogP | 6.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|