C32H29NO3 — CID 46932772
(3R,4R)-3-acetyl-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one (PubChem CID 46932772) has the molecular formula C32H29NO3 and a molecular weight of 475.59 g/mol. Its IUPAC name is (3R,4R)-3-acetyl-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one.
| Compound Name | (3R,4R)-3-acetyl-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
|---|---|
| PubChem CID | 46932772 |
| Molecular Formula | C32H29NO3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (3R,4R)-3-acetyl-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
| SMILES | CC(=O)[C@@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C32H29NO3/c1-24(34)30-29(23-36-22-25-14-6-2-7-15-25)33(31(30)35)32(26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-21,29-30H,22-23H2,1H3/t29-,30-/m0/s1 |
| InChIKey | OLDUJDJTRGYSCI-KYJUHHDHSA-N |
| XLogP | 5.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|