C35H32F3NO2 — CID 15486208
2,2,2-trifluoro-N-(1-phenylbut-3-enyl)-N-(1-trityloxybut-3-en-2-yl)acetamide (PubChem CID 15486208) has the molecular formula C35H32F3NO2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1-phenylbut-3-enyl)-N-(1-trityloxybut-3-en-2-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(1-phenylbut-3-enyl)-N-(1-trityloxybut-3-en-2-yl)acetamide |
|---|---|
| PubChem CID | 15486208 |
| Molecular Formula | C35H32F3NO2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 2,2,2-trifluoro-N-(1-phenylbut-3-enyl)-N-(1-trityloxybut-3-en-2-yl)acetamide |
| SMILES | C=CCC(c1ccccc1)N(C(=O)C(F)(F)F)C(C=C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H32F3NO2/c1-3-17-32(27-18-9-5-10-19-27)39(33(40)35(36,37)38)31(4-2)26-41-34(28-20-11-6-12-21-28,29-22-13-7-14-23-29)30-24-15-8-16-25-30/h3-16,18-25,31-32H,1-2,17,26H2 |
| InChIKey | ZNIQBZRWGVVFJT-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|