C21H30BrN3O3Si — CID 140746933
5-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-nitroquinolin-4-amine (PubChem CID 140746933) has the molecular formula C21H30BrN3O3Si and a molecular weight of 480.48 g/mol. Its IUPAC name is 5-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-nitroquinolin-4-amine.
| Compound Name | 5-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 140746933 |
| Molecular Formula | C21H30BrN3O3Si |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 5-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-nitroquinolin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(Nc2c([N+](=O)[O-])cnc3cccc(Br)c23)CC1 |
| InChI | InChI=1S/C21H30BrN3O3Si/c1-21(2,3)29(4,5)28-15-11-9-14(10-12-15)24-20-18(25(26)27)13-23-17-8-6-7-16(22)19(17)20/h6-8,13-15H,9-12H2,1-5H3,(H,23,24) |
| InChIKey | ZXPVHMDIAKJTMZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|