C15H18BrN3O4 — CID 57455396
7-bromo-N-(4,4-dimethoxybutyl)-3-nitroquinolin-4-amine (PubChem CID 57455396) has the molecular formula C15H18BrN3O4 and a molecular weight of 384.23 g/mol. Its IUPAC name is 7-bromo-N-(4,4-dimethoxybutyl)-3-nitroquinolin-4-amine.
| Compound Name | 7-bromo-N-(4,4-dimethoxybutyl)-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 57455396 |
| Molecular Formula | C15H18BrN3O4 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 7-bromo-N-(4,4-dimethoxybutyl)-3-nitroquinolin-4-amine |
| SMILES | COC(CCCNc1c([N+](=O)[O-])cnc2cc(Br)ccc12)OC |
| InChI | InChI=1S/C15H18BrN3O4/c1-22-14(23-2)4-3-7-17-15-11-6-5-10(16)8-12(11)18-9-13(15)19(20)21/h5-6,8-9,14H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | URUAYGCBXUTURF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|