C19H44O3Si3 — CID 140749420
2,2-bis(trimethylsilyloxymethyl)oct-7-enoxy-trimethylsilane (PubChem CID 140749420) has the molecular formula C19H44O3Si3 and a molecular weight of 404.82 g/mol. Its IUPAC name is 2,2-bis(trimethylsilyloxymethyl)oct-7-enoxy-trimethylsilane.
| Compound Name | 2,2-bis(trimethylsilyloxymethyl)oct-7-enoxy-trimethylsilane |
|---|---|
| PubChem CID | 140749420 |
| Molecular Formula | C19H44O3Si3 |
| Molecular Weight | 404.82 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 2,2-bis(trimethylsilyloxymethyl)oct-7-enoxy-trimethylsilane |
| SMILES | C=CCCCCC(CO[Si](C)(C)C)(CO[Si](C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C19H44O3Si3/c1-11-12-13-14-15-19(16-20-23(2,3)4,17-21-24(5,6)7)18-22-25(8,9)10/h11H,1,12-18H2,2-10H3 |
| InChIKey | WJYJVMWJVVBDMD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.82 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|