C12H17N3O3 — CID 140750328
6-octyl-1,3,5-triazatricyclo[3.1.1.03,6]heptane-2,4,7-trione (PubChem CID 140750328) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 6-octyl-1,3,5-triazatricyclo[3.1.1.03,6]heptane-2,4,7-trione.
| Compound Name | 6-octyl-1,3,5-triazatricyclo[3.1.1.03,6]heptane-2,4,7-trione |
|---|---|
| PubChem CID | 140750328 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 6-octyl-1,3,5-triazatricyclo[3.1.1.03,6]heptane-2,4,7-trione |
| SMILES | CCCCCCCCC12N3C(=O)N1C(=O)N2C3=O |
| InChI | InChI=1S/C12H17N3O3/c1-2-3-4-5-6-7-8-12-13-9(16)14(12)11(18)15(12)10(13)17/h2-8H2,1H3 |
| InChIKey | JFTUHKATNDCBDW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|