C24H23ClN2O5 — CID 1407507
[4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(3-chlorophenyl)propanoate (PubChem CID 1407507) has the molecular formula C24H23ClN2O5 and a molecular weight of 454.91 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(3-chlorophenyl)propanoate.
| Compound Name | [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(3-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 1407507 |
| Molecular Formula | C24H23ClN2O5 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-(3-chlorophenyl)propanoate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)N2CCOCC2)ccc1OC(=O)CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H23ClN2O5/c1-30-22-15-18(13-19(16-26)24(29)27-9-11-31-12-10-27)5-7-21(22)32-23(28)8-6-17-3-2-4-20(25)14-17/h2-5,7,13-15H,6,8-12H2,1H3/b19-13+ |
| InChIKey | AFFHVEMYBOYQOX-CPNJWEJPSA-N |
| XLogP | 3.65 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|