C27H30F3NO7S3 — CID 140753278
[5-[4-(thian-1-ium-1-yl)naphthalen-1-yl]oxycarbonyl-2-adamantyl]oxysulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140753278) has the molecular formula C27H30F3NO7S3 and a molecular weight of 633.73 g/mol. Its IUPAC name is [5-[4-(thian-1-ium-1-yl)naphthalen-1-yl]oxycarbonyl-2-adamantyl]oxysulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [5-[4-(thian-1-ium-1-yl)naphthalen-1-yl]oxycarbonyl-2-adamantyl]oxysulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140753278 |
| Molecular Formula | C27H30F3NO7S3 |
| Molecular Weight | 633.73 g/mol |
| Exact Mass | 633.11 |
| IUPAC Name | [5-[4-(thian-1-ium-1-yl)naphthalen-1-yl]oxycarbonyl-2-adamantyl]oxysulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=C(Oc1ccc([S+]2CCCCC2)c2ccccc12)C12CC3CC(C1)C(OS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)C(C3)C2 |
| InChI | InChI=1S/C27H30F3NO7S3/c28-27(29,30)40(33,34)31-41(35,36)38-24-18-12-17-13-19(24)16-26(14-17,15-18)25(32)37-22-8-9-23(39-10-4-1-5-11-39)21-7-3-2-6-20(21)22/h2-3,6-9,17-19,24H,1,4-5,10-16H2 |
| InChIKey | JWNNFIJMERUPOH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|