C17H16F3NO6S3 — CID 140753327
[4-[2-(thiolan-1-ium-1-yl)acetyl]naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140753327) has the molecular formula C17H16F3NO6S3 and a molecular weight of 483.51 g/mol. Its IUPAC name is [4-[2-(thiolan-1-ium-1-yl)acetyl]naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-[2-(thiolan-1-ium-1-yl)acetyl]naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140753327 |
| Molecular Formula | C17H16F3NO6S3 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | [4-[2-(thiolan-1-ium-1-yl)acetyl]naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=C(C[S+]1CCCC1)c1ccc(OS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C17H16F3NO6S3/c18-17(19,20)29(23,24)21-30(25,26)27-16-8-7-13(12-5-1-2-6-14(12)16)15(22)11-28-9-3-4-10-28/h1-2,5-8H,3-4,9-11H2 |
| InChIKey | CUJZVQKOPRHTSF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|