C30H55NO4 — CID 140753439
4-(7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate;triethylazanium (PubChem CID 140753439) has the molecular formula C30H55NO4 and a molecular weight of 493.77 g/mol. Its IUPAC name is 4-(7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate;triethylazanium.
| Compound Name | 4-(7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate;triethylazanium |
|---|---|
| PubChem CID | 140753439 |
| Molecular Formula | C30H55NO4 |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 493.41 |
| IUPAC Name | 4-(7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate;triethylazanium |
| SMILES | CC(CCC(=O)[O-])C1CCC2C3C(O)CC4CCCCC4(C)C3CC(O)C12C.CC[NH+](CC)CC |
| InChI | InChI=1S/C24H40O4.C6H15N/c1-14(7-10-21(27)28)16-8-9-17-22-18(13-20(26)24(16,17)3)23(2)11-5-4-6-15(23)12-19(22)25;1-4-7(5-2)6-3/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28);4-6H2,1-3H3 |
| InChIKey | WNZZWYWGYZWATI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |