C24H42O2 — CID 163648711
(7R,8R,9S,12S,14S,17R)-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol (PubChem CID 163648711) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is (7R,8R,9S,12S,14S,17R)-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol.
| Compound Name | (7R,8R,9S,12S,14S,17R)-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol |
|---|---|
| PubChem CID | 163648711 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | (7R,8R,9S,12S,14S,17R)-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol |
| SMILES | CCCC(C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)CC4CCCCC4(C)[C@H]3C[C@H](O)C12C |
| InChI | InChI=1S/C24H42O2/c1-5-8-15(2)17-10-11-18-22-19(14-21(26)24(17,18)4)23(3)12-7-6-9-16(23)13-20(22)25/h15-22,25-26H,5-14H2,1-4H3/t15?,16?,17-,18+,19+,20-,21+,22+,23?,24?/m1/s1 |
| InChIKey | IKJSLADKIQHFIJ-UUYQDMTCSA-N |
| XLogP | 5.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |