C25H44O2 — CID 163439447
3,10,13-trimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol (PubChem CID 163439447) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 3,10,13-trimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol.
| Compound Name | 3,10,13-trimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol |
|---|---|
| PubChem CID | 163439447 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 3,10,13-trimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,12-diol |
| SMILES | CCCC(C)C1CCC2C3C(O)CC4CC(C)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C25H44O2/c1-6-7-16(3)18-8-9-19-23-20(14-22(27)25(18,19)5)24(4)11-10-15(2)12-17(24)13-21(23)26/h15-23,26-27H,6-14H2,1-5H3 |
| InChIKey | AXGLKVFPZQNKFB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |