C48H46N2Si — CID 140757038
8,8-dimethyl-5-N,14-N-diphenyl-5-N,14-N-bis(2,4,6-trimethylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine (PubChem CID 140757038) has the molecular formula C48H46N2Si and a molecular weight of 679.00 g/mol. Its IUPAC name is 8,8-dimethyl-5-N,14-N-diphenyl-5-N,14-N-bis(2,4,6-trimethylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine.
| Compound Name | 8,8-dimethyl-5-N,14-N-diphenyl-5-N,14-N-bis(2,4,6-trimethylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine |
|---|---|
| PubChem CID | 140757038 |
| Molecular Formula | C48H46N2Si |
| Molecular Weight | 679.00 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | 8,8-dimethyl-5-N,14-N-diphenyl-5-N,14-N-bis(2,4,6-trimethylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine |
| SMILES | Cc1cc(C)c(N(c2ccccc2)c2ccc3c(c2)[Si](C)(C)c2cccc4c(N(c5ccccc5)c5c(C)cc(C)cc5C)ccc-3c24)c(C)c1 |
| InChI | InChI=1S/C48H46N2Si/c1-31-26-33(3)47(34(4)27-31)49(37-16-11-9-12-17-37)39-22-23-40-41-24-25-43(42-20-15-21-44(46(41)42)51(7,8)45(40)30-39)50(38-18-13-10-14-19-38)48-35(5)28-32(2)29-36(48)6/h9-30H,1-8H3 |
| InChIKey | HYJHHROGPPYKMC-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.00 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|