C49H44N2Si2 — CID 140757029
8,8-dimethyl-14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine (PubChem CID 140757029) has the molecular formula C49H44N2Si2 and a molecular weight of 717.08 g/mol. Its IUPAC name is 8,8-dimethyl-14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine.
| Compound Name | 8,8-dimethyl-14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine |
|---|---|
| PubChem CID | 140757029 |
| Molecular Formula | C49H44N2Si2 |
| Molecular Weight | 717.08 g/mol |
| Exact Mass | 716.30 |
| IUPAC Name | 8,8-dimethyl-14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccccc2)c2ccc3c(c2)[Si](C)(C)c2cccc4c(N(c5ccccc5)c5ccc6ccccc6c5)ccc-3c24)cc1 |
| InChI | InChI=1S/C49H44N2Si2/c1-52(2,3)42-28-25-39(26-29-42)50(37-17-8-6-9-18-37)41-27-30-43-44-31-32-46(45-21-14-22-47(49(44)45)53(4,5)48(43)34-41)51(38-19-10-7-11-20-38)40-24-23-35-15-12-13-16-36(35)33-40/h6-34H,1-5H3 |
| InChIKey | XHXVBZQPIUSAPP-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.08 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|