C47H38N2SSi — CID 123316620
14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine (PubChem CID 123316620) has the molecular formula C47H38N2SSi and a molecular weight of 690.99 g/mol. Its IUPAC name is 14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine.
| Compound Name | 14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine |
|---|---|
| PubChem CID | 123316620 |
| Molecular Formula | C47H38N2SSi |
| Molecular Weight | 690.99 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 14-N-naphthalen-2-yl-5-N,14-N-diphenyl-5-N-(4-trimethylsilylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene-5,14-diamine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccccc2)c2ccc3c(c2)Sc2cccc4c(N(c5ccccc5)c5ccc6ccccc6c5)ccc-3c24)cc1 |
| InChI | InChI=1S/C47H38N2SSi/c1-51(2,3)40-26-23-37(24-27-40)48(35-15-6-4-7-16-35)39-25-28-41-42-29-30-44(43-19-12-20-45(47(42)43)50-46(41)32-39)49(36-17-8-5-9-18-36)38-22-21-33-13-10-11-14-34(33)31-38/h4-32H,1-3H3 |
| InChIKey | AVLCPHAGLMOFAS-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.99 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|