C17H14FeP- — CID 140759998
cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;iron (PubChem CID 140759998) has the molecular formula C17H14FeP- and a molecular weight of 305.12 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;iron.
| Compound Name | cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;iron |
|---|---|
| PubChem CID | 140759998 |
| Molecular Formula | C17H14FeP- |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;iron |
| SMILES | [Fe].c1ccc(P(c2ccccc2)c2cc[cH-]c2)cc1 |
| InChI | InChI=1S/C17H14P.Fe/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;/h1-14H;/q-1; |
| InChIKey | IVHSOQRPAFCTQT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|