C39H21N5 — CID 140760426
9-[3-[6-isocyano-9-(2-isocyanophenyl)carbazol-1-yl]phenyl]carbazole-3-carbonitrile (PubChem CID 140760426) has the molecular formula C39H21N5 and a molecular weight of 559.63 g/mol. Its IUPAC name is 9-[3-[6-isocyano-9-(2-isocyanophenyl)carbazol-1-yl]phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[3-[6-isocyano-9-(2-isocyanophenyl)carbazol-1-yl]phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140760426 |
| Molecular Formula | C39H21N5 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 9-[3-[6-isocyano-9-(2-isocyanophenyl)carbazol-1-yl]phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cccc(-c3cccc(-n4c5ccccc5c5cc(C#N)ccc54)c3)c1n2-c1ccccc1[N+]#[C-] |
| InChI | InChI=1S/C39H21N5/c1-41-27-18-20-37-33(23-27)31-13-8-12-29(39(31)44(37)38-16-6-4-14-34(38)42-2)26-9-7-10-28(22-26)43-35-15-5-3-11-30(35)32-21-25(24-40)17-19-36(32)43/h3-23H |
| InChIKey | HDSZJOFSXVHPEA-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 42.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|