C27H23F3O2S — CID 140761205
(triphenyl-λ4-sulfanyl) 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 140761205) has the molecular formula C27H23F3O2S and a molecular weight of 468.54 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (triphenyl-λ4-sulfanyl) 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 140761205 |
| Molecular Formula | C27H23F3O2S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C1(C(F)(F)F)CC2C=CC1C2 |
| InChI | InChI=1S/C27H23F3O2S/c28-27(29,30)26(19-20-16-17-21(26)18-20)25(31)32-33(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-17,20-21H,18-19H2 |
| InChIKey | NRAAINSMAMZABK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|