C19H17BF4N2O4 — CID 140761700
5-fluoro-1-hydroxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3H-2,1-benzoxaborole-6-carboxamide (PubChem CID 140761700) has the molecular formula C19H17BF4N2O4 and a molecular weight of 424.16 g/mol. Its IUPAC name is 5-fluoro-1-hydroxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3H-2,1-benzoxaborole-6-carboxamide.
| Compound Name | 5-fluoro-1-hydroxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3H-2,1-benzoxaborole-6-carboxamide |
|---|---|
| PubChem CID | 140761700 |
| Molecular Formula | C19H17BF4N2O4 |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-fluoro-1-hydroxy-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3H-2,1-benzoxaborole-6-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCOCC1)c1cc2c(cc1F)COB2O |
| InChI | InChI=1S/C19H17BF4N2O4/c21-15-7-11-10-30-20(28)14(11)9-13(15)18(27)25-16-8-12(19(22,23)24)1-2-17(16)26-3-5-29-6-4-26/h1-2,7-9,28H,3-6,10H2,(H,25,27) |
| InChIKey | PXGIFMJKVVFZEA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|