C18H15BN2O3S — CID 140761886
1-hydroxy-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3H-2,1-benzoxaborole-6-carboxamide (PubChem CID 140761886) has the molecular formula C18H15BN2O3S and a molecular weight of 350.21 g/mol. Its IUPAC name is 1-hydroxy-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3H-2,1-benzoxaborole-6-carboxamide.
| Compound Name | 1-hydroxy-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3H-2,1-benzoxaborole-6-carboxamide |
|---|---|
| PubChem CID | 140761886 |
| Molecular Formula | C18H15BN2O3S |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-hydroxy-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3H-2,1-benzoxaborole-6-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3ccc4c(c3)B(O)OC4)n2)cc1 |
| InChI | InChI=1S/C18H15BN2O3S/c1-11-2-4-12(5-3-11)16-10-25-18(20-16)21-17(22)13-6-7-14-9-24-19(23)15(14)8-13/h2-8,10,23H,9H2,1H3,(H,20,21,22) |
| InChIKey | IHPSJQBMALCXQK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|