C24H25N3O3S — CID 140763302
(3S)-3-(3-ethynylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-2-(2-oxo-3H-1,3-benzothiazol-5-yl)butanamide (PubChem CID 140763302) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is (3S)-3-(3-ethynylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-2-(2-oxo-3H-1,3-benzothiazol-5-yl)butanamide.
| Compound Name | (3S)-3-(3-ethynylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-2-(2-oxo-3H-1,3-benzothiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 140763302 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (3S)-3-(3-ethynylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-2-(2-oxo-3H-1,3-benzothiazol-5-yl)butanamide |
| SMILES | C#Cc1cccc([C@@H](CN2CC[C@H](O)C2)C(C(=O)NC)c2ccc3sc(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C24H25N3O3S/c1-3-15-5-4-6-16(11-15)19(14-27-10-9-18(28)13-27)22(23(29)25-2)17-7-8-21-20(12-17)26-24(30)31-21/h1,4-8,11-12,18-19,22,28H,9-10,13-14H2,2H3,(H,25,29)(H,26,30)/t18-,19+,22?/m0/s1 |
| InChIKey | SNGREASRLHODGO-ZKTCVHQMSA-N |
| XLogP | 2.25 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|