C24H27N3O3 — CID 140764119
(3S)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-3-phenyl-2-quinolin-6-yloxybutanamide (PubChem CID 140764119) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (3S)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-3-phenyl-2-quinolin-6-yloxybutanamide.
| Compound Name | (3S)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-3-phenyl-2-quinolin-6-yloxybutanamide |
|---|---|
| PubChem CID | 140764119 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (3S)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methyl-3-phenyl-2-quinolin-6-yloxybutanamide |
| SMILES | CNC(=O)C(Oc1ccc2ncccc2c1)[C@H](CN1CC[C@H](O)C1)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O3/c1-25-24(29)23(30-20-9-10-22-18(14-20)8-5-12-26-22)21(17-6-3-2-4-7-17)16-27-13-11-19(28)15-27/h2-10,12,14,19,21,23,28H,11,13,15-16H2,1H3,(H,25,29)/t19-,21+,23?/m0/s1 |
| InChIKey | HXJCJPATOQEVAB-ZPVUCFGCSA-N |
| XLogP | 2.58 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |