C30H35BN4O2 — CID 140763704
methyl-[4-[4-[2-(morpholin-4-ylmethyl)-1-phenylpyrrolo[3,2-c]pyridin-4-yl]phenyl]piperidin-1-yl]borinic acid (PubChem CID 140763704) has the molecular formula C30H35BN4O2 and a molecular weight of 494.45 g/mol. Its IUPAC name is methyl-[4-[4-[2-(morpholin-4-ylmethyl)-1-phenylpyrrolo[3,2-c]pyridin-4-yl]phenyl]piperidin-1-yl]borinic acid.
| Compound Name | methyl-[4-[4-[2-(morpholin-4-ylmethyl)-1-phenylpyrrolo[3,2-c]pyridin-4-yl]phenyl]piperidin-1-yl]borinic acid |
|---|---|
| PubChem CID | 140763704 |
| Molecular Formula | C30H35BN4O2 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | methyl-[4-[4-[2-(morpholin-4-ylmethyl)-1-phenylpyrrolo[3,2-c]pyridin-4-yl]phenyl]piperidin-1-yl]borinic acid |
| SMILES | CB(O)N1CCC(c2ccc(-c3nccc4c3cc(CN3CCOCC3)n4-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C30H35BN4O2/c1-31(36)34-15-12-24(13-16-34)23-7-9-25(10-8-23)30-28-21-27(22-33-17-19-37-20-18-33)35(29(28)11-14-32-30)26-5-3-2-4-6-26/h2-11,14,21,24,36H,12-13,15-20,22H2,1H3 |
| InChIKey | QLALVMGUPNIXQW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|