C23H32FNO5S — CID 140765532
tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylsulfonyloxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzoate (PubChem CID 140765532) has the molecular formula C23H32FNO5S and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylsulfonyloxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzoate.
| Compound Name | tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylsulfonyloxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzoate |
|---|---|
| PubChem CID | 140765532 |
| Molecular Formula | C23H32FNO5S |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylsulfonyloxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(C2CC2)c(CN2C3CCC2CC(OS(C)(=O)=O)C3)cc1F |
| InChI | InChI=1S/C23H32FNO5S/c1-23(2,3)29-22(26)20-12-19(14-5-6-14)15(9-21(20)24)13-25-16-7-8-17(25)11-18(10-16)30-31(4,27)28/h9,12,14,16-18H,5-8,10-11,13H2,1-4H3 |
| InChIKey | PYCSDXWZPFSSQL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|