C28H36ClF2NO3 — CID 118120674
tert-butyl 4-[[4-[(3Z,5E)-7-chloro-5-fluoro-2-methylidenehepta-3,5-dienoxy]piperidin-1-yl]methyl]-5-cyclopropyl-2-fluorobenzoate (PubChem CID 118120674) has the molecular formula C28H36ClF2NO3 and a molecular weight of 508.05 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(3Z,5E)-7-chloro-5-fluoro-2-methylidenehepta-3,5-dienoxy]piperidin-1-yl]methyl]-5-cyclopropyl-2-fluorobenzoate.
| Compound Name | tert-butyl 4-[[4-[(3Z,5E)-7-chloro-5-fluoro-2-methylidenehepta-3,5-dienoxy]piperidin-1-yl]methyl]-5-cyclopropyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 118120674 |
| Molecular Formula | C28H36ClF2NO3 |
| Molecular Weight | 508.05 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | tert-butyl 4-[[4-[(3Z,5E)-7-chloro-5-fluoro-2-methylidenehepta-3,5-dienoxy]piperidin-1-yl]methyl]-5-cyclopropyl-2-fluorobenzoate |
| SMILES | C=C(/C=C\C(F)=C/CCl)COC1CCN(Cc2cc(F)c(C(=O)OC(C)(C)C)cc2C2CC2)CC1 |
| InChI | InChI=1S/C28H36ClF2NO3/c1-19(5-8-22(30)9-12-29)18-34-23-10-13-32(14-11-23)17-21-15-26(31)25(16-24(21)20-6-7-20)27(33)35-28(2,3)4/h5,8-9,15-16,20,23H,1,6-7,10-14,17-18H2,2-4H3/b8-5-,22-9+ |
| InChIKey | HVKYUZRXZNGDNG-XUUSRBPNSA-N |
| XLogP | 6.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.05 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|