C22H24F2N2O2 — CID 118120359
5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]benzamide (PubChem CID 118120359) has the molecular formula C22H24F2N2O2 and a molecular weight of 386.44 g/mol. Its IUPAC name is 5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]benzamide.
| Compound Name | 5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 118120359 |
| Molecular Formula | C22H24F2N2O2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1cc(C2CC2)c(CN2CCC(Oc3ccc(F)cc3)CC2)cc1F |
| InChI | InChI=1S/C22H24F2N2O2/c23-16-3-5-17(6-4-16)28-18-7-9-26(10-8-18)13-15-11-21(24)20(22(25)27)12-19(15)14-1-2-14/h3-6,11-12,14,18H,1-2,7-10,13H2,(H2,25,27) |
| InChIKey | BDEZBUPLSPXIGR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |