C22H22F2N2O3 — CID 144850175
5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]-N-oxobenzamide (PubChem CID 144850175) has the molecular formula C22H22F2N2O3 and a molecular weight of 400.43 g/mol. Its IUPAC name is 5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]-N-oxobenzamide.
| Compound Name | 5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]-N-oxobenzamide |
|---|---|
| PubChem CID | 144850175 |
| Molecular Formula | C22H22F2N2O3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 5-cyclopropyl-2-fluoro-4-[[4-(4-fluorophenoxy)piperidin-1-yl]methyl]-N-oxobenzamide |
| SMILES | O=NC(=O)c1cc(C2CC2)c(CN2CCC(Oc3ccc(F)cc3)CC2)cc1F |
| InChI | InChI=1S/C22H22F2N2O3/c23-16-3-5-17(6-4-16)29-18-7-9-26(10-8-18)13-15-11-21(24)20(22(27)25-28)12-19(15)14-1-2-14/h3-6,11-12,14,18H,1-2,7-10,13H2 |
| InChIKey | XLVBVQOOBWBMCE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |