C25H30F4N2O4S — CID 162572308
N-[[5-cyclopropyl-2-fluoro-4-[[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methyl]phenyl]methoxymethyl]-N-hydroxymethanesulfinamide (PubChem CID 162572308) has the molecular formula C25H30F4N2O4S and a molecular weight of 530.58 g/mol. Its IUPAC name is N-[[5-cyclopropyl-2-fluoro-4-[[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methyl]phenyl]methoxymethyl]-N-hydroxymethanesulfinamide.
| Compound Name | N-[[5-cyclopropyl-2-fluoro-4-[[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methyl]phenyl]methoxymethyl]-N-hydroxymethanesulfinamide |
|---|---|
| PubChem CID | 162572308 |
| Molecular Formula | C25H30F4N2O4S |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | N-[[5-cyclopropyl-2-fluoro-4-[[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methyl]phenyl]methoxymethyl]-N-hydroxymethanesulfinamide |
| SMILES | CS(=O)N(O)COCc1cc(C2CC2)c(CN2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C25H30F4N2O4S/c1-36(33)31(32)16-34-15-19-12-23(17-2-3-17)18(13-24(19)26)14-30-10-8-22(9-11-30)35-21-6-4-20(5-7-21)25(27,28)29/h4-7,12-13,17,22,32H,2-3,8-11,14-16H2,1H3 |
| InChIKey | HNXSKRWYVHRKGQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|