C21H37NO4 — CID 14076773
tert-butyl N-[2-cyclohexyl-1-[4-(2-methylpropyl)-5-oxooxolan-2-yl]ethyl]carbamate (PubChem CID 14076773) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is tert-butyl N-[2-cyclohexyl-1-[4-(2-methylpropyl)-5-oxooxolan-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclohexyl-1-[4-(2-methylpropyl)-5-oxooxolan-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 14076773 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | tert-butyl N-[2-cyclohexyl-1-[4-(2-methylpropyl)-5-oxooxolan-2-yl]ethyl]carbamate |
| SMILES | CC(C)CC1CC(C(CC2CCCCC2)NC(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C21H37NO4/c1-14(2)11-16-13-18(25-19(16)23)17(12-15-9-7-6-8-10-15)22-20(24)26-21(3,4)5/h14-18H,6-13H2,1-5H3,(H,22,24) |
| InChIKey | WWZSFAIZKXCSKS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |