C20H36FNO6 — CID 86678429
6-O-tert-butyl 1-O-ethyl (5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate (PubChem CID 86678429) has the molecular formula C20H36FNO6 and a molecular weight of 405.51 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-ethyl (5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-ethyl (5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate |
|---|---|
| PubChem CID | 86678429 |
| Molecular Formula | C20H36FNO6 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 6-O-tert-butyl 1-O-ethyl (5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate |
| SMILES | CCOC(=O)C(CCCF)CC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36FNO6/c1-8-26-16(23)14(10-9-13-21)11-12-15(17(24)27-19(2,3)4)22-18(25)28-20(5,6)7/h14-15H,8-13H2,1-7H3,(H,22,25)/t14?,15-/m0/s1 |
| InChIKey | OVBWPKWGENQSRF-LOACHALJSA-N |
| XLogP | 3.93 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|