C21H22N6O4 — CID 140767799
[4-[(4-ethoxy-5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone (PubChem CID 140767799) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is [4-[(4-ethoxy-5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(4-ethoxy-5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 140767799 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [4-[(4-ethoxy-5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino]-3-methoxyphenyl]-morpholin-4-ylmethanone |
| SMILES | [C-]#[N+]c1c[nH]c2nc(Nc3ccc(C(=O)N4CCOCC4)cc3OC)nc(OCC)c12 |
| InChI | InChI=1S/C21H22N6O4/c1-4-31-19-17-15(22-2)12-23-18(17)25-21(26-19)24-14-6-5-13(11-16(14)29-3)20(28)27-7-9-30-10-8-27/h5-6,11-12H,4,7-10H2,1,3H3,(H2,23,24,25,26) |
| InChIKey | USNJAQIIBUTDGG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|