C44H24N6 — CID 140769007
4-[6-[9-[6-(2-isocyano-4-pyridinyl)-2-pyridinyl]benzo[b]triphenylen-14-yl]-2-pyridinyl]pyridine-2-carbonitrile (PubChem CID 140769007) has the molecular formula C44H24N6 and a molecular weight of 636.72 g/mol. Its IUPAC name is 4-[6-[9-[6-(2-isocyano-4-pyridinyl)-2-pyridinyl]benzo[b]triphenylen-14-yl]-2-pyridinyl]pyridine-2-carbonitrile.
| Compound Name | 4-[6-[9-[6-(2-isocyano-4-pyridinyl)-2-pyridinyl]benzo[b]triphenylen-14-yl]-2-pyridinyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 140769007 |
| Molecular Formula | C44H24N6 |
| Molecular Weight | 636.72 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 4-[6-[9-[6-(2-isocyano-4-pyridinyl)-2-pyridinyl]benzo[b]triphenylen-14-yl]-2-pyridinyl]pyridine-2-carbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cccc(-c3c4ccccc4c(-c4cccc(-c5ccnc(C#N)c5)n4)c4c5ccccc5c5ccccc5c34)n2)ccn1 |
| InChI | InChI=1S/C44H24N6/c1-46-40-25-28(21-23-48-40)37-17-9-19-39(50-37)42-35-15-7-6-14-34(35)41(38-18-8-16-36(49-38)27-20-22-47-29(24-27)26-45)43-32-12-4-2-10-30(32)31-11-3-5-13-33(31)44(42)43/h2-25H |
| InChIKey | AZGQRXMLBGLPTH-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.72 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|