C28H14N4 — CID 140769354
4-[7-(2-isocyano-4-pyridinyl)pyren-2-yl]pyridine-2-carbonitrile (PubChem CID 140769354) has the molecular formula C28H14N4 and a molecular weight of 406.45 g/mol. Its IUPAC name is 4-[7-(2-isocyano-4-pyridinyl)pyren-2-yl]pyridine-2-carbonitrile.
| Compound Name | 4-[7-(2-isocyano-4-pyridinyl)pyren-2-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 140769354 |
| Molecular Formula | C28H14N4 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 4-[7-(2-isocyano-4-pyridinyl)pyren-2-yl]pyridine-2-carbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cc3ccc4cc(-c5ccnc(C#N)c5)cc5ccc(c2)c3c45)ccn1 |
| InChI | InChI=1S/C28H14N4/c1-30-26-15-18(7-9-32-26)24-12-21-4-2-19-10-23(17-6-8-31-25(14-17)16-29)11-20-3-5-22(13-24)28(21)27(19)20/h2-15H |
| InChIKey | VAPBRHVOBZEIQZ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|