C44H24N4O — CID 140769347
2-[3-[15-[3-(4-isocyano-2-pyridinyl)phenyl]-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl]phenyl]pyridine-4-carbonitrile (PubChem CID 140769347) has the molecular formula C44H24N4O and a molecular weight of 624.70 g/mol. Its IUPAC name is 2-[3-[15-[3-(4-isocyano-2-pyridinyl)phenyl]-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl]phenyl]pyridine-4-carbonitrile.
| Compound Name | 2-[3-[15-[3-(4-isocyano-2-pyridinyl)phenyl]-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl]phenyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 140769347 |
| Molecular Formula | C44H24N4O |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | 2-[3-[15-[3-(4-isocyano-2-pyridinyl)phenyl]-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl]phenyl]pyridine-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccnc(-c2cccc(-c3cc4oc5cc(-c6cccc(-c7cc(C#N)ccn7)c6)c6ccccc6c5c4c4ccccc34)c2)c1 |
| InChI | InChI=1S/C44H24N4O/c1-46-32-17-19-48-40(23-32)31-11-7-9-29(22-31)38-25-42-44(36-15-5-3-13-34(36)38)43-35-14-4-2-12-33(35)37(24-41(43)49-42)28-8-6-10-30(21-28)39-20-27(26-45)16-18-47-39/h2-25H |
| InChIKey | HWMISPKTCPIGAA-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 67.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|