C37H22N4 — CID 140769533
2-[7-(4-isocyano-2-pyridinyl)-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile (PubChem CID 140769533) has the molecular formula C37H22N4 and a molecular weight of 522.61 g/mol. Its IUPAC name is 2-[7-(4-isocyano-2-pyridinyl)-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[7-(4-isocyano-2-pyridinyl)-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 140769533 |
| Molecular Formula | C37H22N4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 2-[7-(4-isocyano-2-pyridinyl)-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccnc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(-c4cc(C#N)ccn4)ccc2-3)c1 |
| InChI | InChI=1S/C37H22N4/c1-39-30-17-19-41-36(23-30)27-13-15-32-31-14-12-26(35-20-25(24-38)16-18-40-35)21-33(31)37(34(32)22-27,28-8-4-2-5-9-28)29-10-6-3-7-11-29/h2-23H |
| InChIKey | XVVSREWKQGFBNL-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|