C58H37N2OP — CID 140877500
7-[(7-isocyano-9,9-diphenylfluoren-2-yl)-phenylphosphoryl]-9,9-diphenylfluorene-2-carbonitrile (PubChem CID 140877500) has the molecular formula C58H37N2OP and a molecular weight of 808.92 g/mol. Its IUPAC name is 7-[(7-isocyano-9,9-diphenylfluoren-2-yl)-phenylphosphoryl]-9,9-diphenylfluorene-2-carbonitrile.
| Compound Name | 7-[(7-isocyano-9,9-diphenylfluoren-2-yl)-phenylphosphoryl]-9,9-diphenylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 140877500 |
| Molecular Formula | C58H37N2OP |
| Molecular Weight | 808.92 g/mol |
| Exact Mass | 808.26 |
| IUPAC Name | 7-[(7-isocyano-9,9-diphenylfluoren-2-yl)-phenylphosphoryl]-9,9-diphenylfluorene-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(P(=O)(c3ccccc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc(C#N)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C58H37N2OP/c1-60-45-28-32-50-52-34-30-48(38-56(52)58(54(50)36-45,43-21-11-4-12-22-43)44-23-13-5-14-24-44)62(61,46-25-15-6-16-26-46)47-29-33-51-49-31-27-40(39-59)35-53(49)57(55(51)37-47,41-17-7-2-8-18-41)42-19-9-3-10-20-42/h2-38H |
| InChIKey | YLAPXJFFAHOTAI-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.92 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|