C37H26N4 — CID 144925453
2-[7-[(2E,4Z)-5-amino-3-cyanopenta-2,4-dienyl]-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile (PubChem CID 144925453) has the molecular formula C37H26N4 and a molecular weight of 526.64 g/mol. Its IUPAC name is 2-[7-[(2E,4Z)-5-amino-3-cyanopenta-2,4-dienyl]-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[7-[(2E,4Z)-5-amino-3-cyanopenta-2,4-dienyl]-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 144925453 |
| Molecular Formula | C37H26N4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-[7-[(2E,4Z)-5-amino-3-cyanopenta-2,4-dienyl]-9,9-diphenylfluoren-2-yl]pyridine-4-carbonitrile |
| SMILES | N#CC(/C=C\N)=C/Cc1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(-c3cc(C#N)ccn3)ccc1-2 |
| InChI | InChI=1S/C37H26N4/c38-19-17-27(24-39)12-11-26-13-15-32-33-16-14-29(36-22-28(25-40)18-20-41-36)23-35(33)37(34(32)21-26,30-7-3-1-4-8-30)31-9-5-2-6-10-31/h1-10,12-23H,11,38H2/b19-17-,27-12+ |
| InChIKey | CHUNBRSUCCUVBS-QEEAGEIBSA-N |
| XLogP | 7.45 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|