C36H27N3 — CID 144924992
(3E,5Z)-6-amino-4-[6-(9,9-diphenylfluoren-2-yl)-2-pyridinyl]hexa-3,5-dienenitrile (PubChem CID 144924992) has the molecular formula C36H27N3 and a molecular weight of 501.63 g/mol. Its IUPAC name is (3E,5Z)-6-amino-4-[6-(9,9-diphenylfluoren-2-yl)-2-pyridinyl]hexa-3,5-dienenitrile.
| Compound Name | (3E,5Z)-6-amino-4-[6-(9,9-diphenylfluoren-2-yl)-2-pyridinyl]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 144924992 |
| Molecular Formula | C36H27N3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (3E,5Z)-6-amino-4-[6-(9,9-diphenylfluoren-2-yl)-2-pyridinyl]hexa-3,5-dienenitrile |
| SMILES | N#CC/C=C(\C=C/N)c1cccc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)n1 |
| InChI | InChI=1S/C36H27N3/c37-23-10-11-26(22-24-38)34-18-9-19-35(39-34)27-20-21-31-30-16-7-8-17-32(30)36(33(31)25-27,28-12-3-1-4-13-28)29-14-5-2-6-15-29/h1-9,11-22,24-25H,10,38H2/b24-22-,26-11+ |
| InChIKey | NMLACOKXOLYXKT-SOCPXQQVSA-N |
| XLogP | 7.88 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|