C37H27N — CID 144924807
(3Z)-5-(7,9,9-triphenylfluoren-2-yl)hexa-3,5-dienenitrile (PubChem CID 144924807) has the molecular formula C37H27N and a molecular weight of 485.63 g/mol. Its IUPAC name is (3Z)-5-(7,9,9-triphenylfluoren-2-yl)hexa-3,5-dienenitrile.
| Compound Name | (3Z)-5-(7,9,9-triphenylfluoren-2-yl)hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 144924807 |
| Molecular Formula | C37H27N |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | (3Z)-5-(7,9,9-triphenylfluoren-2-yl)hexa-3,5-dienenitrile |
| SMILES | C=C(/C=C\CC#N)c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(-c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C37H27N/c1-27(13-11-12-24-38)29-20-22-33-34-23-21-30(28-14-5-2-6-15-28)26-36(34)37(35(33)25-29,31-16-7-3-8-17-31)32-18-9-4-10-19-32/h2-11,13-23,25-26H,1,12H2/b13-11- |
| InChIKey | YZIRARRCNRJPDA-QBFSEMIESA-N |
| XLogP | 9.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|