C49H33N3 — CID 144924661
(Z)-4-[4-[7'-[4-[(3Z)-5-cyanopenta-1,3-dien-2-yl]phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-5-imino-2-methylidenepent-3-enenitrile (PubChem CID 144924661) has the molecular formula C49H33N3 and a molecular weight of 663.82 g/mol. Its IUPAC name is (Z)-4-[4-[7'-[4-[(3Z)-5-cyanopenta-1,3-dien-2-yl]phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-5-imino-2-methylidenepent-3-enenitrile.
| Compound Name | (Z)-4-[4-[7'-[4-[(3Z)-5-cyanopenta-1,3-dien-2-yl]phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-5-imino-2-methylidenepent-3-enenitrile |
|---|---|
| PubChem CID | 144924661 |
| Molecular Formula | C49H33N3 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | (Z)-4-[4-[7'-[4-[(3Z)-5-cyanopenta-1,3-dien-2-yl]phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-5-imino-2-methylidenepent-3-enenitrile |
| SMILES | [H]/N=C/C(=C\C(=C)C#N)c1ccc(-c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2cc(-c4ccc(C(=C)/C=C\CC#N)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C49H33N3/c1-32(30-51)27-40(31-52)37-20-18-36(19-21-37)39-23-25-44-43-24-22-38(35-16-14-34(15-17-35)33(2)9-7-8-26-50)28-47(43)49(48(44)29-39)45-12-5-3-10-41(45)42-11-4-6-13-46(42)49/h3-7,9-25,27-29,31,52H,1-2,8H2/b9-7-,40-27+,52-31+ |
| InChIKey | LIGADRVDJHRWOD-HCRSLERZSA-N |
| XLogP | 11.96 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|