C41H28N2 — CID 144924907
(2E)-4-[4-(7,7-diphenylbenzo[c]fluoren-10-yl)phenyl]-2-methanimidoylpenta-2,4-dienenitrile (PubChem CID 144924907) has the molecular formula C41H28N2 and a molecular weight of 548.69 g/mol. Its IUPAC name is (2E)-4-[4-(7,7-diphenylbenzo[c]fluoren-10-yl)phenyl]-2-methanimidoylpenta-2,4-dienenitrile.
| Compound Name | (2E)-4-[4-(7,7-diphenylbenzo[c]fluoren-10-yl)phenyl]-2-methanimidoylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 144924907 |
| Molecular Formula | C41H28N2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (2E)-4-[4-(7,7-diphenylbenzo[c]fluoren-10-yl)phenyl]-2-methanimidoylpenta-2,4-dienenitrile |
| SMILES | [H]/N=C/C(C#N)=C\C(=C)c1ccc(-c2ccc3c(c2)-c2c(ccc4ccccc24)C3(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H28N2/c1-28(24-29(26-42)27-43)30-16-18-31(19-17-30)33-21-22-38-37(25-33)40-36-15-9-8-10-32(36)20-23-39(40)41(38,34-11-4-2-5-12-34)35-13-6-3-7-14-35/h2-26,42H,1H2/b29-24+,42-26+ |
| InChIKey | UYCQTZIZWHSSPU-FZGBGAAOSA-N |
| XLogP | 9.98 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|